10,12-docosadiynedioic acid

🙚 Home 🙚 Tables for Chemistry 🙘 Compound classes 🙘

10,12-docosadiynedioic acid
CAS RN:[28393-02-4]
Formula:C22H34O4; 362.51 g/mol
InChiKey:XCUAGNLOPZWTEH-UHFFFAOYSA-N
SMILES:OC(=O)CCCCCCCCC#CC#CCCCCCCCCC(O)=O
Molecular structure of 10,12-docosadiynedioic acid
Melting point:111 °C

Isomers

diheptyl benzene-1,3-dicarboxylate
Molecular structure of diheptyl benzene-1,3-dicarboxylate
diheptyl benzene-1,4-dicarboxylate
Molecular structure of diheptyl benzene-1,4-dicarboxylate
diheptyl phthalate
Molecular structure of diheptyl phthalate
diisoheptyl phthalate
Molecular structure of diisoheptyl phthalate
10,12-docosadiynedioic acid
Molecular structure of 10,12-docosadiynedioic acid
  ::